About 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline
8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline (PubChem CID 126757737) has the molecular formula C10H9FN2
and a molecular weight of 176.19 g/mol. Its IUPAC name is 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline.
Molecular Properties
| Compound Name | 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline |
| PubChem CID | 126757737 |
| Molecular Formula | C10H9FN2 |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline |
| SMILES | C=CC1=CC=C(F)C2C=CN=NC12 |
| InChI | InChI=1S/C10H9FN2/c1-2-7-3-4-9(11)8-5-6-12-13-10(7)8/h2-6,8,10H,1H2 |
| InChIKey | YKJSYAKWPYQWOK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline?
The IUPAC name of 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline (CID 126757737) is 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline.
What is the SMILES notation for 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline?
The canonical SMILES for 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline is C=CC1=CC=C(F)C2C=CN=NC12.
What is the InChIKey of 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline?
The InChIKey is YKJSYAKWPYQWOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2/c1-2-7-3-4-9(11)8-5-6-12-13-10(7)8/h2-6,8,10H,1H2.
What are the key properties of 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline?
8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline has a molecular weight of 176.19 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethenyl-5-fluoro-4a,8a-dihydrocinnoline is sourced from PubChem (CID 126757737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).