C28H46O4 — CID 126758261
propan-2-yl 3-acetyloxy-3-(9,10-ditert-butyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propanoate (PubChem CID 126758261) has the molecular formula C28H46O4 and a molecular weight of 446.67 g/mol. Its IUPAC name is propan-2-yl 3-acetyloxy-3-(9,10-ditert-butyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propanoate.
| Compound Name | propan-2-yl 3-acetyloxy-3-(9,10-ditert-butyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propanoate |
|---|---|
| PubChem CID | 126758261 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | propan-2-yl 3-acetyloxy-3-(9,10-ditert-butyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)propanoate |
| SMILES | CC(=O)OC(CC(=O)OC(C)C)C1CC2CC1C1C3CC(C21)C(C(C)(C)C)C3C(C)(C)C |
| InChI | InChI=1S/C28H46O4/c1-14(2)31-22(30)13-21(32-15(3)29)17-10-16-11-18(17)24-20-12-19(23(16)24)25(27(4,5)6)26(20)28(7,8)9/h14,16-21,23-26H,10-13H2,1-9H3 |
| InChIKey | GMRLDRSWWYNFMD-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|