About 5-benzyl-1,4-dimethylpyrazole
5-benzyl-1,4-dimethylpyrazole (PubChem CID 126758584) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 5-benzyl-1,4-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-benzyl-1,4-dimethylpyrazole |
| PubChem CID | 126758584 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 5-benzyl-1,4-dimethylpyrazole |
| SMILES | Cc1cnn(C)c1Cc1ccccc1 |
| InChI | InChI=1S/C12H14N2/c1-10-9-13-14(2)12(10)8-11-6-4-3-5-7-11/h3-7,9H,8H2,1-2H3 |
| InChIKey | ZZDPJADAMCXMJY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-benzyl-1,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-1,4-dimethylpyrazole?
The IUPAC name of 5-benzyl-1,4-dimethylpyrazole (CID 126758584) is 5-benzyl-1,4-dimethylpyrazole.
What is the SMILES notation for 5-benzyl-1,4-dimethylpyrazole?
The canonical SMILES for 5-benzyl-1,4-dimethylpyrazole is Cc1cnn(C)c1Cc1ccccc1.
What is the InChIKey of 5-benzyl-1,4-dimethylpyrazole?
The InChIKey is ZZDPJADAMCXMJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-10-9-13-14(2)12(10)8-11-6-4-3-5-7-11/h3-7,9H,8H2,1-2H3.
What are the key properties of 5-benzyl-1,4-dimethylpyrazole?
5-benzyl-1,4-dimethylpyrazole has a molecular weight of 186.26 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-1,4-dimethylpyrazole is sourced from PubChem (CID 126758584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).