C11H16F3NO2 — CID 126758814
1-(1-acetylpiperidin-4-yl)-4,4,4-trifluorobutan-1-one (PubChem CID 126758814) has the molecular formula C11H16F3NO2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 126758814 |
| Molecular Formula | C11H16F3NO2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-4,4,4-trifluorobutan-1-one |
| SMILES | CC(=O)N1CCC(C(=O)CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H16F3NO2/c1-8(16)15-6-3-9(4-7-15)10(17)2-5-11(12,13)14/h9H,2-7H2,1H3 |
| InChIKey | GBUIQCAIHASUCZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |