About [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid
[1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid (PubChem CID 126759063) has the molecular formula C10H21F2O6P
and a molecular weight of 306.24 g/mol. Its IUPAC name is [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid.
Molecular Properties
| Compound Name | [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid |
| PubChem CID | 126759063 |
| Molecular Formula | C10H21F2O6P |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid |
| SMILES | CC(C)OCCOCCOCCC(F)(F)P(=O)(O)O |
| InChI | InChI=1S/C10H21F2O6P/c1-9(2)18-8-7-17-6-5-16-4-3-10(11,12)19(13,14)15/h9H,3-8H2,1-2H3,(H2,13,14,15) |
| InChIKey | ZFFWUASWCYEKOV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid?
The IUPAC name of [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid (CID 126759063) is [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid.
What is the SMILES notation for [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid?
The canonical SMILES for [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid is CC(C)OCCOCCOCCC(F)(F)P(=O)(O)O.
What is the InChIKey of [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid?
The InChIKey is ZFFWUASWCYEKOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F2O6P/c1-9(2)18-8-7-17-6-5-16-4-3-10(11,12)19(13,14)15/h9H,3-8H2,1-2H3,(H2,13,14,15).
What are the key properties of [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid?
[1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid has a molecular weight of 306.24 g/mol, XLogP of 1.61, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-difluoro-3-[2-(2-propan-2-yloxyethoxy)ethoxy]propyl]phosphonic acid is sourced from PubChem (CID 126759063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).