About N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide
N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide (PubChem CID 126759157) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide.
Molecular Properties
| Compound Name | N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide |
| PubChem CID | 126759157 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide |
| SMILES | C[C@@H](O)[C@@H](CO)NC=O |
| InChI | InChI=1S/C5H11NO3/c1-4(9)5(2-7)6-3-8/h3-5,7,9H,2H2,1H3,(H,6,8)/t4-,5-/m1/s1 |
| InChIKey | UMCMEOMVMZSDHS-RFZPGFLSSA-N |
| XLogP | -1.53 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide?
The IUPAC name of N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide (CID 126759157) is N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide.
What is the SMILES notation for N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide?
The canonical SMILES for N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide is C[C@@H](O)[C@@H](CO)NC=O.
What is the InChIKey of N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide?
The InChIKey is UMCMEOMVMZSDHS-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H11NO3/c1-4(9)5(2-7)6-3-8/h3-5,7,9H,2H2,1H3,(H,6,8)/t4-,5-/m1/s1.
What are the key properties of N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide?
N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide has a molecular weight of 133.15 g/mol, XLogP of -1.53, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,3R)-1,3-dihydroxybutan-2-yl]formamide is sourced from PubChem (CID 126759157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).