About 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one
1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one (PubChem CID 126759806) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one |
| PubChem CID | 126759806 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one |
| SMILES | O=c1ncccn1CC(O)[C@H](O)CO |
| InChI | InChI=1S/C8H12N2O4/c11-5-7(13)6(12)4-10-3-1-2-9-8(10)14/h1-3,6-7,11-13H,4-5H2/t6?,7-/m1/s1 |
| InChIKey | ZCELJXJLUKTSDY-COBSHVIPSA-N |
| XLogP | -2.04 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one?
The IUPAC name of 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one (CID 126759806) is 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one.
What is the SMILES notation for 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one?
The canonical SMILES for 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one is O=c1ncccn1CC(O)[C@H](O)CO.
What is the InChIKey of 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one?
The InChIKey is ZCELJXJLUKTSDY-COBSHVIPSA-N. The full InChI is InChI=1S/C8H12N2O4/c11-5-7(13)6(12)4-10-3-1-2-9-8(10)14/h1-3,6-7,11-13H,4-5H2/t6?,7-/m1/s1.
What are the key properties of 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one?
1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one has a molecular weight of 200.19 g/mol, XLogP of -2.04, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-2,3,4-trihydroxybutyl]pyrimidin-2-one is sourced from PubChem (CID 126759806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).