C13H19NO6 — CID 126760014
4-O-[2-[(3S,4R)-2-hydroxy-3,4-dimethyl-5-oxopyrrolidin-1-yl]ethyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 126760014) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is 4-O-[2-[(3S,4R)-2-hydroxy-3,4-dimethyl-5-oxopyrrolidin-1-yl]ethyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[(3S,4R)-2-hydroxy-3,4-dimethyl-5-oxopyrrolidin-1-yl]ethyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126760014 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-O-[2-[(3S,4R)-2-hydroxy-3,4-dimethyl-5-oxopyrrolidin-1-yl]ethyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCCN1C(=O)[C@H](C)[C@H](C)C1O |
| InChI | InChI=1S/C13H19NO6/c1-8-9(2)13(18)14(12(8)17)6-7-20-11(16)5-4-10(15)19-3/h4-5,8-9,12,17H,6-7H2,1-3H3/b5-4+/t8-,9+,12?/m0/s1 |
| InChIKey | GIVBWAWUJYXOSH-FTBLYYJSSA-N |
| XLogP | -0.31 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|