About (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol
(2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol (PubChem CID 126760692) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol.
Molecular Properties
| Compound Name | (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol |
| PubChem CID | 126760692 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol |
| SMILES | CO/C(C)=C(O)/C=C(\C)N |
| InChI | InChI=1S/C7H13NO2/c1-5(8)4-7(9)6(2)10-3/h4,9H,8H2,1-3H3/b5-4+,7-6- |
| InChIKey | PKKYXKIQVMWWLI-DEQVHDEQSA-N |
| XLogP | 1.28 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol?
The IUPAC name of (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol (CID 126760692) is (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol.
What is the SMILES notation for (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol?
The canonical SMILES for (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol is CO/C(C)=C(O)/C=C(\C)N.
What is the InChIKey of (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol?
The InChIKey is PKKYXKIQVMWWLI-DEQVHDEQSA-N. The full InChI is InChI=1S/C7H13NO2/c1-5(8)4-7(9)6(2)10-3/h4,9H,8H2,1-3H3/b5-4+,7-6-.
What are the key properties of (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol?
(2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol has a molecular weight of 143.19 g/mol, XLogP of 1.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-5-amino-2-methoxyhexa-2,4-dien-3-ol is sourced from PubChem (CID 126760692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).