About 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate
8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate (PubChem CID 126760740) has the molecular formula C15H24O2
and a molecular weight of 236.35 g/mol. Its IUPAC name is 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate |
| PubChem CID | 126760740 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C15H24O2/c1-15(2,3)14(16)17-13-8-9-7-12(13)11-6-4-5-10(9)11/h9-13H,4-8H2,1-3H3 |
| InChIKey | LVBHKOSRBSEZPR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate?
The IUPAC name of 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate (CID 126760740) is 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate.
What is the SMILES notation for 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate?
The canonical SMILES for 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OC1CC2CC1C1CCCC21.
What is the InChIKey of 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate?
The InChIKey is LVBHKOSRBSEZPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2/c1-15(2,3)14(16)17-13-8-9-7-12(13)11-6-4-5-10(9)11/h9-13H,4-8H2,1-3H3.
What are the key properties of 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate?
8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate has a molecular weight of 236.35 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tricyclo[5.2.1.02,6]decanyl 2,2-dimethylpropanoate is sourced from PubChem (CID 126760740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).