C22H33N5O3S — CID 126761267
trans-(1R,2R)-2-[[6-[[(1-hydroxy-2-methylimino-2-morpholin-4-ylethyl)-methylamino]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol (PubChem CID 126761267) has the molecular formula C22H33N5O3S and a molecular weight of 447.61 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[6-[[(1-hydroxy-2-methylimino-2-morpholin-4-ylethyl)-methylamino]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[[6-[[(1-hydroxy-2-methylimino-2-morpholin-4-ylethyl)-methylamino]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 126761267 |
| Molecular Formula | C22H33N5O3S |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | trans-(1R,2R)-2-[[6-[[(1-hydroxy-2-methylimino-2-morpholin-4-ylethyl)-methylamino]methyl]-1,3-benzothiazol-2-yl]amino]cyclohexan-1-ol |
| SMILES | C/N=C(/C(O)N(C)Cc1ccc2nc(N[C@@H]3CCCC[C@H]3O)sc2c1)N1CCOCC1 |
| InChI | InChI=1S/C22H33N5O3S/c1-23-20(27-9-11-30-12-10-27)21(29)26(2)14-15-7-8-17-19(13-15)31-22(25-17)24-16-5-3-4-6-18(16)28/h7-8,13,16,18,21,28-29H,3-6,9-12,14H2,1-2H3,(H,24,25)/b23-20-/t16-,18-,21?/m1/s1 |
| InChIKey | VNGZXZLTFYLNPA-OQOUBPCUSA-N |
| XLogP | 2.12 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|