C25H32N2O2 — CID 126761519
3-[cyclopentyl(methyl)amino]-2-methyl-5-[4-(morpholin-4-ylmethyl)phenyl]benzaldehyde (PubChem CID 126761519) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 3-[cyclopentyl(methyl)amino]-2-methyl-5-[4-(morpholin-4-ylmethyl)phenyl]benzaldehyde.
| Compound Name | 3-[cyclopentyl(methyl)amino]-2-methyl-5-[4-(morpholin-4-ylmethyl)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 126761519 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 3-[cyclopentyl(methyl)amino]-2-methyl-5-[4-(morpholin-4-ylmethyl)phenyl]benzaldehyde |
| SMILES | Cc1c(C=O)cc(-c2ccc(CN3CCOCC3)cc2)cc1N(C)C1CCCC1 |
| InChI | InChI=1S/C25H32N2O2/c1-19-23(18-28)15-22(16-25(19)26(2)24-5-3-4-6-24)21-9-7-20(8-10-21)17-27-11-13-29-14-12-27/h7-10,15-16,18,24H,3-6,11-14,17H2,1-2H3 |
| InChIKey | ZXKAWOHWSGICFV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|