C38H23N3 — CID 126761593
3-carbazol-9-yl-5-[3-[3-(3-cyanophenyl)phenyl]phenyl]benzonitrile (PubChem CID 126761593) has the molecular formula C38H23N3 and a molecular weight of 521.62 g/mol. Its IUPAC name is 3-carbazol-9-yl-5-[3-[3-(3-cyanophenyl)phenyl]phenyl]benzonitrile.
| Compound Name | 3-carbazol-9-yl-5-[3-[3-(3-cyanophenyl)phenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 126761593 |
| Molecular Formula | C38H23N3 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 3-carbazol-9-yl-5-[3-[3-(3-cyanophenyl)phenyl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cccc(-c3cccc(-c4cc(C#N)cc(-n5c6ccccc6c6ccccc65)c4)c3)c2)c1 |
| InChI | InChI=1S/C38H23N3/c39-24-26-8-5-9-28(18-26)29-10-6-11-30(21-29)31-12-7-13-32(22-31)33-19-27(25-40)20-34(23-33)41-37-16-3-1-14-35(37)36-15-2-4-17-38(36)41/h1-23H |
| InChIKey | GBHZLTWRVHXCKB-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 52.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |