C45H24N4S — CID 126761763
9-[3-cyano-5-[4-(3-phenylphenyl)dibenzothiophen-2-yl]phenyl]carbazole-3,6-dicarbonitrile (PubChem CID 126761763) has the molecular formula C45H24N4S and a molecular weight of 652.78 g/mol. Its IUPAC name is 9-[3-cyano-5-[4-(3-phenylphenyl)dibenzothiophen-2-yl]phenyl]carbazole-3,6-dicarbonitrile.
| Compound Name | 9-[3-cyano-5-[4-(3-phenylphenyl)dibenzothiophen-2-yl]phenyl]carbazole-3,6-dicarbonitrile |
|---|---|
| PubChem CID | 126761763 |
| Molecular Formula | C45H24N4S |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.17 |
| IUPAC Name | 9-[3-cyano-5-[4-(3-phenylphenyl)dibenzothiophen-2-yl]phenyl]carbazole-3,6-dicarbonitrile |
| SMILES | N#Cc1cc(-c2cc(-c3cccc(-c4ccccc4)c3)c3sc4ccccc4c3c2)cc(-n2c3ccc(C#N)cc3c3cc(C#N)ccc32)c1 |
| InChI | InChI=1S/C45H24N4S/c46-25-28-13-15-42-39(19-28)40-20-29(26-47)14-16-43(40)49(42)36-18-30(27-48)17-34(22-36)35-23-38(45-41(24-35)37-11-4-5-12-44(37)50-45)33-10-6-9-32(21-33)31-7-2-1-3-8-31/h1-24H |
| InChIKey | BGYNGIYXXLUSRK-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |