About [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol
[2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol (PubChem CID 126761882) has the molecular formula C22H26F6N2O
and a molecular weight of 448.45 g/mol. Its IUPAC name is [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol.
Molecular Properties
| Compound Name | [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol |
| PubChem CID | 126761882 |
| Molecular Formula | C22H26F6N2O |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol |
| SMILES | CCCCCN1CCCCC1C(O)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C22H26F6N2O/c1-2-3-5-11-30-12-6-4-10-17(30)20(31)15-13-18(22(26,27)28)29-19-14(15)8-7-9-16(19)21(23,24)25/h7-9,13,17,20,31H,2-6,10-12H2,1H3 |
| InChIKey | HFLSUGSMUKHVQM-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol?
The IUPAC name of [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol (CID 126761882) is [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol.
What is the SMILES notation for [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol?
The canonical SMILES for [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol is CCCCCN1CCCCC1C(O)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12.
What is the InChIKey of [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol?
The InChIKey is HFLSUGSMUKHVQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26F6N2O/c1-2-3-5-11-30-12-6-4-10-17(30)20(31)15-13-18(22(26,27)28)29-19-14(15)8-7-9-16(19)21(23,24)25/h7-9,13,17,20,31H,2-6,10-12H2,1H3.
What are the key properties of [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol?
[2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol has a molecular weight of 448.45 g/mol, XLogP of 6.35, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,8-bis(trifluoromethyl)quinolin-4-yl]-(1-pentylpiperidin-2-yl)methanol is sourced from PubChem (CID 126761882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).