C16H20F3N3O4S — CID 126762058
(3aR,6S,7R,7aR)-2-(dimethylamino)-5-[(1R)-2,2,2-trifluoro-1-(pyridin-3-ylmethoxy)ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 126762058) has the molecular formula C16H20F3N3O4S and a molecular weight of 407.41 g/mol. Its IUPAC name is (3aR,6S,7R,7aR)-2-(dimethylamino)-5-[(1R)-2,2,2-trifluoro-1-(pyridin-3-ylmethoxy)ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,6S,7R,7aR)-2-(dimethylamino)-5-[(1R)-2,2,2-trifluoro-1-(pyridin-3-ylmethoxy)ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 126762058 |
| Molecular Formula | C16H20F3N3O4S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (3aR,6S,7R,7aR)-2-(dimethylamino)-5-[(1R)-2,2,2-trifluoro-1-(pyridin-3-ylmethoxy)ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | CN(C)C1=N[C@@H]2[C@@H](O)[C@H](O)C([C@@H](OCc3cccnc3)C(F)(F)F)O[C@@H]2S1 |
| InChI | InChI=1S/C16H20F3N3O4S/c1-22(2)15-21-9-10(23)11(24)12(26-14(9)27-15)13(16(17,18)19)25-7-8-4-3-5-20-6-8/h3-6,9-14,23-24H,7H2,1-2H3/t9-,10-,11+,12?,13-,14-/m1/s1 |
| InChIKey | BPNPGXVLRAJRBB-GSWZFVNLSA-N |
| XLogP | 1.01 |
| TPSA | 87.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |