About 1-amino-3-propylurea
1-amino-3-propylurea (PubChem CID 12676227) has the molecular formula C4H11N3O
and a molecular weight of 117.15 g/mol. Its IUPAC name is 1-amino-3-propylurea.
Molecular Properties
| Compound Name | 1-amino-3-propylurea |
| PubChem CID | 12676227 |
| Molecular Formula | C4H11N3O |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | 1-amino-3-propylurea |
| SMILES | CCCNC(=O)NN |
| InChI | InChI=1S/C4H11N3O/c1-2-3-6-4(8)7-5/h2-3,5H2,1H3,(H2,6,7,8) |
| InChIKey | JVQWYTBVNPMEAH-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-propylurea?
The IUPAC name of 1-amino-3-propylurea (CID 12676227) is 1-amino-3-propylurea.
What is the SMILES notation for 1-amino-3-propylurea?
The canonical SMILES for 1-amino-3-propylurea is CCCNC(=O)NN.
What is the InChIKey of 1-amino-3-propylurea?
The InChIKey is JVQWYTBVNPMEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3O/c1-2-3-6-4(8)7-5/h2-3,5H2,1H3,(H2,6,7,8).
What are the key properties of 1-amino-3-propylurea?
1-amino-3-propylurea has a molecular weight of 117.15 g/mol, XLogP of -0.43, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-propylurea is sourced from PubChem (CID 12676227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).