About 1-amino-3-butylurea
1-amino-3-butylurea (PubChem CID 12676228) has the molecular formula C5H13N3O
and a molecular weight of 131.18 g/mol. Its IUPAC name is 1-amino-3-butylurea.
Molecular Properties
| Compound Name | 1-amino-3-butylurea |
| PubChem CID | 12676228 |
| Molecular Formula | C5H13N3O |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | 1-amino-3-butylurea |
| SMILES | CCCCNC(=O)NN |
| InChI | InChI=1S/C5H13N3O/c1-2-3-4-7-5(9)8-6/h2-4,6H2,1H3,(H2,7,8,9) |
| InChIKey | OQGXXDLQVFZTAD-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-butylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-butylurea?
The IUPAC name of 1-amino-3-butylurea (CID 12676228) is 1-amino-3-butylurea.
What is the SMILES notation for 1-amino-3-butylurea?
The canonical SMILES for 1-amino-3-butylurea is CCCCNC(=O)NN.
What is the InChIKey of 1-amino-3-butylurea?
The InChIKey is OQGXXDLQVFZTAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O/c1-2-3-4-7-5(9)8-6/h2-4,6H2,1H3,(H2,7,8,9).
What are the key properties of 1-amino-3-butylurea?
1-amino-3-butylurea has a molecular weight of 131.18 g/mol, XLogP of -0.04, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-butylurea is sourced from PubChem (CID 12676228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).