About 1-amino-3-butylurea;hydrochloride
1-amino-3-butylurea;hydrochloride (PubChem CID 12676229) has the molecular formula C5H14ClN3O
and a molecular weight of 167.64 g/mol. Its IUPAC name is 1-amino-3-butylurea;hydrochloride.
Molecular Properties
| Compound Name | 1-amino-3-butylurea;hydrochloride |
| PubChem CID | 12676229 |
| Molecular Formula | C5H14ClN3O |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 1-amino-3-butylurea;hydrochloride |
| SMILES | CCCCNC(=O)NN.Cl |
| InChI | InChI=1S/C5H13N3O.ClH/c1-2-3-4-7-5(9)8-6;/h2-4,6H2,1H3,(H2,7,8,9);1H |
| InChIKey | ABVSQHHOWZBZTR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-butylurea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-butylurea;hydrochloride?
The IUPAC name of 1-amino-3-butylurea;hydrochloride (CID 12676229) is 1-amino-3-butylurea;hydrochloride.
What is the SMILES notation for 1-amino-3-butylurea;hydrochloride?
The canonical SMILES for 1-amino-3-butylurea;hydrochloride is CCCCNC(=O)NN.Cl.
What is the InChIKey of 1-amino-3-butylurea;hydrochloride?
The InChIKey is ABVSQHHOWZBZTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O.ClH/c1-2-3-4-7-5(9)8-6;/h2-4,6H2,1H3,(H2,7,8,9);1H.
What are the key properties of 1-amino-3-butylurea;hydrochloride?
1-amino-3-butylurea;hydrochloride has a molecular weight of 167.64 g/mol, XLogP of 0.38, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-butylurea;hydrochloride is sourced from PubChem (CID 12676229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).