C29H32F4N4O4 — CID 126762469
(3-fluoro-2-pyrimidin-2-ylphenyl)-[2-(methoxymethoxymethyl)-3-methyl-6-[1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propyl]piperidin-1-yl]methanone (PubChem CID 126762469) has the molecular formula C29H32F4N4O4 and a molecular weight of 576.59 g/mol. Its IUPAC name is (3-fluoro-2-pyrimidin-2-ylphenyl)-[2-(methoxymethoxymethyl)-3-methyl-6-[1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propyl]piperidin-1-yl]methanone.
| Compound Name | (3-fluoro-2-pyrimidin-2-ylphenyl)-[2-(methoxymethoxymethyl)-3-methyl-6-[1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 126762469 |
| Molecular Formula | C29H32F4N4O4 |
| Molecular Weight | 576.59 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | (3-fluoro-2-pyrimidin-2-ylphenyl)-[2-(methoxymethoxymethyl)-3-methyl-6-[1-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propyl]piperidin-1-yl]methanone |
| SMILES | CCC(Oc1ccc(C(F)(F)F)cn1)C1CCC(C)C(COCOC)N1C(=O)c1cccc(F)c1-c1ncccn1 |
| InChI | InChI=1S/C29H32F4N4O4/c1-4-24(41-25-12-10-19(15-36-25)29(31,32)33)22-11-9-18(2)23(16-40-17-39-3)37(22)28(38)20-7-5-8-21(30)26(20)27-34-13-6-14-35-27/h5-8,10,12-15,18,22-24H,4,9,11,16-17H2,1-3H3 |
| InChIKey | UQZZSCZKYCBDKB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|