C8H11NO — CID 126762505
(1Z,3Z,6Z)-6-aminocycloocta-1,3,6-trien-1-ol (PubChem CID 126762505) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (1Z,3Z,6Z)-6-aminocycloocta-1,3,6-trien-1-ol.
| Compound Name | (1Z,3Z,6Z)-6-aminocycloocta-1,3,6-trien-1-ol |
|---|---|
| PubChem CID | 126762505 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (1Z,3Z,6Z)-6-aminocycloocta-1,3,6-trien-1-ol |
| SMILES | N/C1=C/C/C(O)=C\C=C/C1 |
| InChI | InChI=1S/C8H11NO/c9-7-3-1-2-4-8(10)6-5-7/h1-2,4-5,10H,3,6,9H2/b2-1-,7-5+,8-4+ |
| InChIKey | IHUROVRHBNNPST-RRFLBZICSA-N |
| XLogP | 1.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |