About 2-diazo-3,4-dihydronaphthalen-1-one
2-diazo-3,4-dihydronaphthalen-1-one (PubChem CID 12676285) has the molecular formula C10H8N2O
and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-diazo-3,4-dihydronaphthalen-1-one.
Molecular Properties
| Compound Name | 2-diazo-3,4-dihydronaphthalen-1-one |
| PubChem CID | 12676285 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 2-diazo-3,4-dihydronaphthalen-1-one |
| SMILES | [N-]=[N+]=C1CCc2ccccc2C1=O |
| InChI | InChI=1S/C10H8N2O/c11-12-9-6-5-7-3-1-2-4-8(7)10(9)13/h1-4H,5-6H2 |
| InChIKey | BDZGAPNZRQNDAK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-diazo-3,4-dihydronaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazo-3,4-dihydronaphthalen-1-one?
The IUPAC name of 2-diazo-3,4-dihydronaphthalen-1-one (CID 12676285) is 2-diazo-3,4-dihydronaphthalen-1-one.
What is the SMILES notation for 2-diazo-3,4-dihydronaphthalen-1-one?
The canonical SMILES for 2-diazo-3,4-dihydronaphthalen-1-one is [N-]=[N+]=C1CCc2ccccc2C1=O.
What is the InChIKey of 2-diazo-3,4-dihydronaphthalen-1-one?
The InChIKey is BDZGAPNZRQNDAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O/c11-12-9-6-5-7-3-1-2-4-8(7)10(9)13/h1-4H,5-6H2.
What are the key properties of 2-diazo-3,4-dihydronaphthalen-1-one?
2-diazo-3,4-dihydronaphthalen-1-one has a molecular weight of 172.19 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazo-3,4-dihydronaphthalen-1-one is sourced from PubChem (CID 12676285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).