C27H43ClFN3O — CID 126763028
3-[(4E,6Z)-5-chloro-4-ethylnona-4,6,8-trien-2-yl]-1-[4-[ethyl(methyl)amino]butan-2-yl]-1-[(2E,4E)-5-fluoro-2-methylhepta-2,4,6-trienyl]urea (PubChem CID 126763028) has the molecular formula C27H43ClFN3O and a molecular weight of 480.11 g/mol. Its IUPAC name is 3-[(4E,6Z)-5-chloro-4-ethylnona-4,6,8-trien-2-yl]-1-[4-[ethyl(methyl)amino]butan-2-yl]-1-[(2E,4E)-5-fluoro-2-methylhepta-2,4,6-trienyl]urea.
| Compound Name | 3-[(4E,6Z)-5-chloro-4-ethylnona-4,6,8-trien-2-yl]-1-[4-[ethyl(methyl)amino]butan-2-yl]-1-[(2E,4E)-5-fluoro-2-methylhepta-2,4,6-trienyl]urea |
|---|---|
| PubChem CID | 126763028 |
| Molecular Formula | C27H43ClFN3O |
| Molecular Weight | 480.11 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | 3-[(4E,6Z)-5-chloro-4-ethylnona-4,6,8-trien-2-yl]-1-[4-[ethyl(methyl)amino]butan-2-yl]-1-[(2E,4E)-5-fluoro-2-methylhepta-2,4,6-trienyl]urea |
| SMILES | C=C/C=C\C(Cl)=C(\CC)CC(C)NC(=O)N(C/C(C)=C/C=C(/F)C=C)C(C)CCN(C)CC |
| InChI | InChI=1S/C27H43ClFN3O/c1-9-13-14-26(28)24(10-2)19-22(6)30-27(33)32(23(7)17-18-31(8)12-4)20-21(5)15-16-25(29)11-3/h9,11,13-16,22-23H,1,3,10,12,17-20H2,2,4-8H3,(H,30,33)/b14-13-,21-15+,25-16+,26-24+ |
| InChIKey | QJCJMVKDGFDGQL-DEVMNQNKSA-N |
| XLogP | 7.14 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.11 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|