About 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine
1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine (PubChem CID 126763115) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine.
Molecular Properties
| Compound Name | 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine |
| PubChem CID | 126763115 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine |
| SMILES | C/C=C(\C=C/N(N)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H26N2/c1-8-11(12(2,3)4)9-10-15(14)13(5,6)7/h8-10H,14H2,1-7H3/b10-9-,11-8+ |
| InChIKey | PLMODBIBKCIXIL-LMMFKTOUSA-N |
| XLogP | 3.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine?
The IUPAC name of 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine (CID 126763115) is 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine.
What is the SMILES notation for 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine?
The canonical SMILES for 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine is C/C=C(\C=C/N(N)C(C)(C)C)C(C)(C)C.
What is the InChIKey of 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine?
The InChIKey is PLMODBIBKCIXIL-LMMFKTOUSA-N. The full InChI is InChI=1S/C13H26N2/c1-8-11(12(2,3)4)9-10-15(14)13(5,6)7/h8-10H,14H2,1-7H3/b10-9-,11-8+.
What are the key properties of 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine?
1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine has a molecular weight of 210.36 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-1-[(1Z,3E)-3-tert-butylpenta-1,3-dienyl]hydrazine is sourced from PubChem (CID 126763115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).