C20H30N2 — CID 126763419
(5Z,8Z)-5-ethenyl-8-[(2-methyl-2H-azepin-4-yl)methyl]deca-5,8-dien-4-amine (PubChem CID 126763419) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is (5Z,8Z)-5-ethenyl-8-[(2-methyl-2H-azepin-4-yl)methyl]deca-5,8-dien-4-amine.
| Compound Name | (5Z,8Z)-5-ethenyl-8-[(2-methyl-2H-azepin-4-yl)methyl]deca-5,8-dien-4-amine |
|---|---|
| PubChem CID | 126763419 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | (5Z,8Z)-5-ethenyl-8-[(2-methyl-2H-azepin-4-yl)methyl]deca-5,8-dien-4-amine |
| SMILES | C=C/C(=C/C/C(=C/C)CC1=CC(C)N=CC=C1)C(N)CCC |
| InChI | InChI=1S/C20H30N2/c1-5-9-20(21)19(7-3)12-11-17(6-2)15-18-10-8-13-22-16(4)14-18/h6-8,10,12-14,16,20H,3,5,9,11,15,21H2,1-2,4H3/b17-6-,19-12- |
| InChIKey | LEIGMEBDUVXABY-OLODZVITSA-N |
| XLogP | 4.91 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|