C17H20O6 — CID 126763437
2-hydroxy-3-methoxy-5-(3,4,5-trimethoxycyclohexa-1,3-dien-1-yl)benzaldehyde (PubChem CID 126763437) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-hydroxy-3-methoxy-5-(3,4,5-trimethoxycyclohexa-1,3-dien-1-yl)benzaldehyde.
| Compound Name | 2-hydroxy-3-methoxy-5-(3,4,5-trimethoxycyclohexa-1,3-dien-1-yl)benzaldehyde |
|---|---|
| PubChem CID | 126763437 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-hydroxy-3-methoxy-5-(3,4,5-trimethoxycyclohexa-1,3-dien-1-yl)benzaldehyde |
| SMILES | COC1=C(OC)C(OC)CC(c2cc(C=O)c(O)c(OC)c2)=C1 |
| InChI | InChI=1S/C17H20O6/c1-20-13-6-10(5-12(9-18)16(13)19)11-7-14(21-2)17(23-4)15(8-11)22-3/h5-7,9,15,19H,8H2,1-4H3 |
| InChIKey | KYXWWVNHPJDISN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|