C20H21N5 — CID 126763679
4-(benzotriazol-1-yl)-2-[[(1E)-4-methylhexa-1,5-dienyl]iminomethyl]aniline (PubChem CID 126763679) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-(benzotriazol-1-yl)-2-[[(1E)-4-methylhexa-1,5-dienyl]iminomethyl]aniline.
| Compound Name | 4-(benzotriazol-1-yl)-2-[[(1E)-4-methylhexa-1,5-dienyl]iminomethyl]aniline |
|---|---|
| PubChem CID | 126763679 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-(benzotriazol-1-yl)-2-[[(1E)-4-methylhexa-1,5-dienyl]iminomethyl]aniline |
| SMILES | C=CC(C)C/C=C/N=C/c1cc(-n2nnc3ccccc32)ccc1N |
| InChI | InChI=1S/C20H21N5/c1-3-15(2)7-6-12-22-14-16-13-17(10-11-18(16)21)25-20-9-5-4-8-19(20)23-24-25/h3-6,8-15H,1,7,21H2,2H3/b12-6+,22-14+ |
| InChIKey | DVAQXVNIQWBECL-YXWHGGJZSA-N |
| XLogP | 4.15 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|