C24H36O4 — CID 126763698
(5,7-dihydroxy-10,14-dimethyl-15-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecanyl) propanoate (PubChem CID 126763698) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (5,7-dihydroxy-10,14-dimethyl-15-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecanyl) propanoate.
| Compound Name | (5,7-dihydroxy-10,14-dimethyl-15-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecanyl) propanoate |
|---|---|
| PubChem CID | 126763698 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (5,7-dihydroxy-10,14-dimethyl-15-hexacyclo[9.8.0.02,4.05,10.014,19.016,18]nonadecanyl) propanoate |
| SMILES | CCC(=O)OC1C2CC2C2C3C4CC4C4(O)CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C24H36O4/c1-4-18(26)28-21-14-9-13(14)20-19-15-10-17(15)24(27)11-12(25)5-8-23(24,3)16(19)6-7-22(20,21)2/h12-17,19-21,25,27H,4-11H2,1-3H3 |
| InChIKey | NTCSQQJTLJWYOZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |