C25H33FN2O6S — CID 126763751
N-[(3aS,9bS)-6-(dihydroxymethyl)-2,3a,4,9b-tetrahydro-1H-furo[2,3-c]chromen-7-yl]-2-[3-(diethylamino)propyl]-4-fluorobenzenesulfonamide (PubChem CID 126763751) has the molecular formula C25H33FN2O6S and a molecular weight of 508.61 g/mol. Its IUPAC name is N-[(3aS,9bS)-6-(dihydroxymethyl)-2,3a,4,9b-tetrahydro-1H-furo[2,3-c]chromen-7-yl]-2-[3-(diethylamino)propyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(3aS,9bS)-6-(dihydroxymethyl)-2,3a,4,9b-tetrahydro-1H-furo[2,3-c]chromen-7-yl]-2-[3-(diethylamino)propyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 126763751 |
| Molecular Formula | C25H33FN2O6S |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | N-[(3aS,9bS)-6-(dihydroxymethyl)-2,3a,4,9b-tetrahydro-1H-furo[2,3-c]chromen-7-yl]-2-[3-(diethylamino)propyl]-4-fluorobenzenesulfonamide |
| SMILES | CCN(CC)CCCc1cc(F)ccc1S(=O)(=O)Nc1ccc2c(c1C(O)O)OC[C@H]1OCC[C@@H]21 |
| InChI | InChI=1S/C25H33FN2O6S/c1-3-28(4-2)12-5-6-16-14-17(26)7-10-22(16)35(31,32)27-20-9-8-19-18-11-13-33-21(18)15-34-24(19)23(20)25(29)30/h7-10,14,18,21,25,27,29-30H,3-6,11-13,15H2,1-2H3/t18-,21+/m0/s1 |
| InChIKey | OZGYPLQZYJHIRS-GHTZIAJQSA-N |
| XLogP | 3.15 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|