C15H15F9N2O3S — CID 126764027
N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-6-pentan-3-ylpyridine-2-carboxamide (PubChem CID 126764027) has the molecular formula C15H15F9N2O3S and a molecular weight of 474.35 g/mol. Its IUPAC name is N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-6-pentan-3-ylpyridine-2-carboxamide.
| Compound Name | N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-6-pentan-3-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 126764027 |
| Molecular Formula | C15H15F9N2O3S |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | N-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)-6-pentan-3-ylpyridine-2-carboxamide |
| SMILES | CCC(CC)c1cccc(C(=O)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C15H15F9N2O3S/c1-3-8(4-2)9-6-5-7-10(25-9)11(27)26-30(28,29)15(23,24)13(18,19)12(16,17)14(20,21)22/h5-8H,3-4H2,1-2H3,(H,26,27) |
| InChIKey | SOFIQBCVGCXAIT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|