C24H30O9S — CID 126764299
methyl (3aR,6S,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-6-(4-methylphenyl)sulfanyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate (PubChem CID 126764299) has the molecular formula C24H30O9S and a molecular weight of 494.56 g/mol. Its IUPAC name is methyl (3aR,6S,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-6-(4-methylphenyl)sulfanyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate.
| Compound Name | methyl (3aR,6S,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-6-(4-methylphenyl)sulfanyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
|---|---|
| PubChem CID | 126764299 |
| Molecular Formula | C24H30O9S |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | methyl (3aR,6S,7aR)-4-[(1R,2R)-1,2-diacetyloxybutyl]-6-(4-methylphenyl)sulfanyl-2-oxo-3a,4,7,7a-tetrahydro-3H-furo[3,2-c]pyran-6-carboxylate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](OC(C)=O)C1O[C@@](Sc2ccc(C)cc2)(C(=O)OC)C[C@H]2OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C24H30O9S/c1-6-18(30-14(3)25)22(31-15(4)26)21-17-11-20(27)32-19(17)12-24(33-21,23(28)29-5)34-16-9-7-13(2)8-10-16/h7-10,17-19,21-22H,6,11-12H2,1-5H3/t17-,18-,19-,21?,22-,24+/m1/s1 |
| InChIKey | XVCJOKPZDRONMG-XJOKVQEDSA-N |
| XLogP | 2.95 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|