C12H6O2S2 — CID 126765623
5,12-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-2(6),3,9(13),10-tetraene-7,14-dione (PubChem CID 126765623) has the molecular formula C12H6O2S2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 5,12-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-2(6),3,9(13),10-tetraene-7,14-dione.
| Compound Name | 5,12-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-2(6),3,9(13),10-tetraene-7,14-dione |
|---|---|
| PubChem CID | 126765623 |
| Molecular Formula | C12H6O2S2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 5,12-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-2(6),3,9(13),10-tetraene-7,14-dione |
| SMILES | O=C1c2sccc2C2C(=O)c3sccc3C12 |
| InChI | InChI=1S/C12H6O2S2/c13-9-7-5-1-3-15-11(5)10(14)8(7)6-2-4-16-12(6)9/h1-4,7-8H |
| InChIKey | BXMVMUXVVTWHEG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |