C19H20FN5OS — CID 126766319
N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide (PubChem CID 126766319) has the molecular formula C19H20FN5OS and a molecular weight of 385.47 g/mol. Its IUPAC name is N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 126766319 |
| Molecular Formula | C19H20FN5OS |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-2-[(4-fluorophenyl)methyl]-1,3-thiazole-5-carboxamide |
| SMILES | CCc1nc2n(n1)CC(NC(=O)c1cnc(Cc3ccc(F)cc3)s1)CC2 |
| InChI | InChI=1S/C19H20FN5OS/c1-2-16-23-17-8-7-14(11-25(17)24-16)22-19(26)15-10-21-18(27-15)9-12-3-5-13(20)6-4-12/h3-6,10,14H,2,7-9,11H2,1H3,(H,22,26) |
| InChIKey | MQENZNHSJCBCDI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |