About N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide
N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide (PubChem CID 126766426) has the molecular formula C22H22N2O4
and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide.
Molecular Properties
| Compound Name | N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide |
| PubChem CID | 126766426 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide |
| SMILES | O=C(COCC1CCOC1)Nc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C22H22N2O4/c25-19(15-27-14-16-11-12-26-13-16)23-22-24-20(17-7-3-1-4-8-17)21(28-22)18-9-5-2-6-10-18/h1-10,16H,11-15H2,(H,23,24,25) |
| InChIKey | NSWDNFAAIOIVFM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide?
The IUPAC name of N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide (CID 126766426) is N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide.
What is the SMILES notation for N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide?
The canonical SMILES for N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide is O=C(COCC1CCOC1)Nc1nc(-c2ccccc2)c(-c2ccccc2)o1.
What is the InChIKey of N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide?
The InChIKey is NSWDNFAAIOIVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O4/c25-19(15-27-14-16-11-12-26-13-16)23-22-24-20(17-7-3-1-4-8-17)21(28-22)18-9-5-2-6-10-18/h1-10,16H,11-15H2,(H,23,24,25).
What are the key properties of N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide?
N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide has a molecular weight of 378.43 g/mol, XLogP of 4.00, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-diphenyl-1,3-oxazol-2-yl)-2-(oxolan-3-ylmethoxy)acetamide is sourced from PubChem (CID 126766426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).