C18H24Cl2N2O3 — CID 126766845
4-[(3,5-dichlorophenoxy)methyl]-N-(oxan-4-yl)piperidine-1-carboxamide (PubChem CID 126766845) has the molecular formula C18H24Cl2N2O3 and a molecular weight of 387.31 g/mol. Its IUPAC name is 4-[(3,5-dichlorophenoxy)methyl]-N-(oxan-4-yl)piperidine-1-carboxamide.
| Compound Name | 4-[(3,5-dichlorophenoxy)methyl]-N-(oxan-4-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126766845 |
| Molecular Formula | C18H24Cl2N2O3 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-[(3,5-dichlorophenoxy)methyl]-N-(oxan-4-yl)piperidine-1-carboxamide |
| SMILES | O=C(NC1CCOCC1)N1CCC(COc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H24Cl2N2O3/c19-14-9-15(20)11-17(10-14)25-12-13-1-5-22(6-2-13)18(23)21-16-3-7-24-8-4-16/h9-11,13,16H,1-8,12H2,(H,21,23) |
| InChIKey | KWGPJGSZMZTMQF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |