About [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride
[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride (PubChem CID 126766938) has the molecular formula C11H14Cl2N2S
and a molecular weight of 277.22 g/mol. Its IUPAC name is [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride.
Molecular Properties
| Compound Name | [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride |
| PubChem CID | 126766938 |
| Molecular Formula | C11H14Cl2N2S |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride |
| SMILES | Cc1ncsc1-c1ccc(CN)cc1.Cl.Cl |
| InChI | InChI=1S/C11H12N2S.2ClH/c1-8-11(14-7-13-8)10-4-2-9(6-12)3-5-10;;/h2-5,7H,6,12H2,1H3;2*1H |
| InChIKey | RVOMTOKXLQIYDC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride?
The IUPAC name of [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride (CID 126766938) is [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride.
What is the SMILES notation for [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride?
The canonical SMILES for [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride is Cc1ncsc1-c1ccc(CN)cc1.Cl.Cl.
What is the InChIKey of [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride?
The InChIKey is RVOMTOKXLQIYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2S.2ClH/c1-8-11(14-7-13-8)10-4-2-9(6-12)3-5-10;;/h2-5,7H,6,12H2,1H3;2*1H.
What are the key properties of [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride?
[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride has a molecular weight of 277.22 g/mol, XLogP of 3.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;dihydrochloride is sourced from PubChem (CID 126766938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).