C18H25N3O3S — CID 126767108
7-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 126767108) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 7-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 126767108 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 7-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-ylsulfonyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1CCCc2cc(S(=O)(=O)N3CCN4CCCCC4C3)ccc2N1 |
| InChI | InChI=1S/C18H25N3O3S/c22-18-6-3-4-14-12-16(7-8-17(14)19-18)25(23,24)21-11-10-20-9-2-1-5-15(20)13-21/h7-8,12,15H,1-6,9-11,13H2,(H,19,22) |
| InChIKey | BBSWXOJWWDURNZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |