C18H18Cl2N4O — CID 126767532
3-[4-[(6,8-dichloro-2H-chromen-3-yl)methyl]piperazin-1-yl]pyridazine (PubChem CID 126767532) has the molecular formula C18H18Cl2N4O and a molecular weight of 377.28 g/mol. Its IUPAC name is 3-[4-[(6,8-dichloro-2H-chromen-3-yl)methyl]piperazin-1-yl]pyridazine.
| Compound Name | 3-[4-[(6,8-dichloro-2H-chromen-3-yl)methyl]piperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 126767532 |
| Molecular Formula | C18H18Cl2N4O |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 3-[4-[(6,8-dichloro-2H-chromen-3-yl)methyl]piperazin-1-yl]pyridazine |
| SMILES | Clc1cc(Cl)c2c(c1)C=C(CN1CCN(c3cccnn3)CC1)CO2 |
| InChI | InChI=1S/C18H18Cl2N4O/c19-15-9-14-8-13(12-25-18(14)16(20)10-15)11-23-4-6-24(7-5-23)17-2-1-3-21-22-17/h1-3,8-10H,4-7,11-12H2 |
| InChIKey | BRBZPZMWSAJPRK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |