C19H25ClN4O2 — CID 126769236
3-[1-(2-chlorophenyl)-4-methylpyrazol-3-yl]-1-[4-(hydroxymethyl)cyclohexyl]-1-methylurea (PubChem CID 126769236) has the molecular formula C19H25ClN4O2 and a molecular weight of 376.89 g/mol. Its IUPAC name is 3-[1-(2-chlorophenyl)-4-methylpyrazol-3-yl]-1-[4-(hydroxymethyl)cyclohexyl]-1-methylurea.
| Compound Name | 3-[1-(2-chlorophenyl)-4-methylpyrazol-3-yl]-1-[4-(hydroxymethyl)cyclohexyl]-1-methylurea |
|---|---|
| PubChem CID | 126769236 |
| Molecular Formula | C19H25ClN4O2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 3-[1-(2-chlorophenyl)-4-methylpyrazol-3-yl]-1-[4-(hydroxymethyl)cyclohexyl]-1-methylurea |
| SMILES | Cc1cn(-c2ccccc2Cl)nc1NC(=O)N(C)C1CCC(CO)CC1 |
| InChI | InChI=1S/C19H25ClN4O2/c1-13-11-24(17-6-4-3-5-16(17)20)22-18(13)21-19(26)23(2)15-9-7-14(12-25)8-10-15/h3-6,11,14-15,25H,7-10,12H2,1-2H3,(H,21,22,26) |
| InChIKey | OQNLCPURYKMTIW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |