About 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine
2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine (PubChem CID 126769421) has the molecular formula C10H10F3N3
and a molecular weight of 229.21 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine.
Molecular Properties
| Compound Name | 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine |
| PubChem CID | 126769421 |
| Molecular Formula | C10H10F3N3 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine |
| SMILES | FC(F)(F)C1=CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C10H10F3N3/c11-10(12,13)8-1-5-16(6-2-8)9-7-14-3-4-15-9/h1,3-4,7H,2,5-6H2 |
| InChIKey | DIFIXSYDFMJAOB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine?
The IUPAC name of 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine (CID 126769421) is 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine.
What is the SMILES notation for 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine?
The canonical SMILES for 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine is FC(F)(F)C1=CCN(c2cnccn2)CC1.
What is the InChIKey of 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine?
The InChIKey is DIFIXSYDFMJAOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3N3/c11-10(12,13)8-1-5-16(6-2-8)9-7-14-3-4-15-9/h1,3-4,7H,2,5-6H2.
What are the key properties of 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine?
2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine has a molecular weight of 229.21 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazine is sourced from PubChem (CID 126769421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).