C11H14FNO2 — CID 126769437
[2-(fluoromethyl)pyrrolidin-1-yl]-(5-methylfuran-3-yl)methanone (PubChem CID 126769437) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is [2-(fluoromethyl)pyrrolidin-1-yl]-(5-methylfuran-3-yl)methanone.
| Compound Name | [2-(fluoromethyl)pyrrolidin-1-yl]-(5-methylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 126769437 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | [2-(fluoromethyl)pyrrolidin-1-yl]-(5-methylfuran-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCCC2CF)co1 |
| InChI | InChI=1S/C11H14FNO2/c1-8-5-9(7-15-8)11(14)13-4-2-3-10(13)6-12/h5,7,10H,2-4,6H2,1H3 |
| InChIKey | SWSCNNAXKPOVQU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |