C16H21N3O3 — CID 126769945
1-[3-(2-methylpyrazol-3-yl)prop-2-enoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 126769945) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-[3-(2-methylpyrazol-3-yl)prop-2-enoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[3-(2-methylpyrazol-3-yl)prop-2-enoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 126769945 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[3-(2-methylpyrazol-3-yl)prop-2-enoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | Cn1nccc1C=CC(=O)N1C(C(=O)O)CC2CCCCC21 |
| InChI | InChI=1S/C16H21N3O3/c1-18-12(8-9-17-18)6-7-15(20)19-13-5-3-2-4-11(13)10-14(19)16(21)22/h6-9,11,13-14H,2-5,10H2,1H3,(H,21,22) |
| InChIKey | CATOLQDMNJKVOU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|