C10H12F6O5 — CID 12677
diethyl 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)propanedioate (PubChem CID 12677) has the molecular formula C10H12F6O5 and a molecular weight of 326.19 g/mol. Its IUPAC name is diethyl 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)propanedioate.
| Compound Name | diethyl 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)propanedioate |
|---|---|
| PubChem CID | 12677 |
| Molecular Formula | C10H12F6O5 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | diethyl 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12F6O5/c1-3-20-6(17)5(7(18)21-4-2)8(19,9(11,12)13)10(14,15)16/h5,19H,3-4H2,1-2H3 |
| InChIKey | HXVWSPYWLBVECZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|