About 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one
1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one (PubChem CID 126770107) has the molecular formula C22H28N2O3
and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one |
| PubChem CID | 126770107 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one |
| SMILES | COc1ccc(CN2CCNC(=O)CC2c2ccccc2)c(OC(C)C)c1 |
| InChI | InChI=1S/C22H28N2O3/c1-16(2)27-21-13-19(26-3)10-9-18(21)15-24-12-11-23-22(25)14-20(24)17-7-5-4-6-8-17/h4-10,13,16,20H,11-12,14-15H2,1-3H3,(H,23,25) |
| InChIKey | IYRKLBPORGDCKP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one?
The IUPAC name of 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one (CID 126770107) is 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one.
What is the SMILES notation for 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one?
The canonical SMILES for 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one is COc1ccc(CN2CCNC(=O)CC2c2ccccc2)c(OC(C)C)c1.
What is the InChIKey of 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one?
The InChIKey is IYRKLBPORGDCKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O3/c1-16(2)27-21-13-19(26-3)10-9-18(21)15-24-12-11-23-22(25)14-20(24)17-7-5-4-6-8-17/h4-10,13,16,20H,11-12,14-15H2,1-3H3,(H,23,25).
What are the key properties of 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one?
1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one has a molecular weight of 368.48 g/mol, XLogP of 3.55, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methoxy-2-propan-2-yloxyphenyl)methyl]-7-phenyl-1,4-diazepan-5-one is sourced from PubChem (CID 126770107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).