C19H25ClN4O — CID 126770991
[1-(2-chlorophenyl)pyrazol-3-yl]-[4-[2-(dimethylamino)ethyl]piperidin-1-yl]methanone (PubChem CID 126770991) has the molecular formula C19H25ClN4O and a molecular weight of 360.89 g/mol. Its IUPAC name is [1-(2-chlorophenyl)pyrazol-3-yl]-[4-[2-(dimethylamino)ethyl]piperidin-1-yl]methanone.
| Compound Name | [1-(2-chlorophenyl)pyrazol-3-yl]-[4-[2-(dimethylamino)ethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 126770991 |
| Molecular Formula | C19H25ClN4O |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [1-(2-chlorophenyl)pyrazol-3-yl]-[4-[2-(dimethylamino)ethyl]piperidin-1-yl]methanone |
| SMILES | CN(C)CCC1CCN(C(=O)c2ccn(-c3ccccc3Cl)n2)CC1 |
| InChI | InChI=1S/C19H25ClN4O/c1-22(2)11-7-15-8-12-23(13-9-15)19(25)17-10-14-24(21-17)18-6-4-3-5-16(18)20/h3-6,10,14-15H,7-9,11-13H2,1-2H3 |
| InChIKey | XUFKINDEDUNGCW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |