About 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea
1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea (PubChem CID 126771483) has the molecular formula C9H14F2N2O
and a molecular weight of 204.22 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea.
Molecular Properties
| Compound Name | 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea |
| PubChem CID | 126771483 |
| Molecular Formula | C9H14F2N2O |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea |
| SMILES | O=C(NCC(F)F)NC1C=CCCC1 |
| InChI | InChI=1S/C9H14F2N2O/c10-8(11)6-12-9(14)13-7-4-2-1-3-5-7/h2,4,7-8H,1,3,5-6H2,(H2,12,13,14) |
| InChIKey | BVWQBIJLEDLVJW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea?
The IUPAC name of 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea (CID 126771483) is 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea.
What is the SMILES notation for 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea?
The canonical SMILES for 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea is O=C(NCC(F)F)NC1C=CCCC1.
What is the InChIKey of 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea?
The InChIKey is BVWQBIJLEDLVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2N2O/c10-8(11)6-12-9(14)13-7-4-2-1-3-5-7/h2,4,7-8H,1,3,5-6H2,(H2,12,13,14).
What are the key properties of 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea?
1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea has a molecular weight of 204.22 g/mol, XLogP of 1.66, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohex-2-en-1-yl-3-(2,2-difluoroethyl)urea is sourced from PubChem (CID 126771483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).