C19H21N5O2 — CID 126772218
4-methyl-2-phenyl-N-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-1,3-oxazole-5-carboxamide (PubChem CID 126772218) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-methyl-2-phenyl-N-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-1,3-oxazole-5-carboxamide.
| Compound Name | 4-methyl-2-phenyl-N-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 126772218 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 4-methyl-2-phenyl-N-[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)oc1C(=O)NC(C)c1nnc2n1CCCC2 |
| InChI | InChI=1S/C19H21N5O2/c1-12-16(26-19(21-12)14-8-4-3-5-9-14)18(25)20-13(2)17-23-22-15-10-6-7-11-24(15)17/h3-5,8-9,13H,6-7,10-11H2,1-2H3,(H,20,25) |
| InChIKey | NRPLCVJSQBLHJH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |