C15H18FNO5S — CID 126773133
1-(5-ethylsulfonyl-2-fluorobenzoyl)piperidine-3-carboxylic acid (PubChem CID 126773133) has the molecular formula C15H18FNO5S and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-(5-ethylsulfonyl-2-fluorobenzoyl)piperidine-3-carboxylic acid.
| Compound Name | 1-(5-ethylsulfonyl-2-fluorobenzoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 126773133 |
| Molecular Formula | C15H18FNO5S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 1-(5-ethylsulfonyl-2-fluorobenzoyl)piperidine-3-carboxylic acid |
| SMILES | CCS(=O)(=O)c1ccc(F)c(C(=O)N2CCCC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C15H18FNO5S/c1-2-23(21,22)11-5-6-13(16)12(8-11)14(18)17-7-3-4-10(9-17)15(19)20/h5-6,8,10H,2-4,7,9H2,1H3,(H,19,20) |
| InChIKey | MTNUJHDARKSDKD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |