About 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one
8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 126776530) has the molecular formula C11H17F2NO
and a molecular weight of 217.26 g/mol. Its IUPAC name is 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one.
Molecular Properties
| Compound Name | 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one |
| PubChem CID | 126776530 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | CC(F)(F)CCN1C2CCC1CC(=O)C2 |
| InChI | InChI=1S/C11H17F2NO/c1-11(12,13)4-5-14-8-2-3-9(14)7-10(15)6-8/h8-9H,2-7H2,1H3 |
| InChIKey | WGBNGXHEZHJSCL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one?
The IUPAC name of 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one (CID 126776530) is 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one.
What is the SMILES notation for 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one?
The canonical SMILES for 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one is CC(F)(F)CCN1C2CCC1CC(=O)C2.
What is the InChIKey of 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one?
The InChIKey is WGBNGXHEZHJSCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2NO/c1-11(12,13)4-5-14-8-2-3-9(14)7-10(15)6-8/h8-9H,2-7H2,1H3.
What are the key properties of 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one?
8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one has a molecular weight of 217.26 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3,3-difluorobutyl)-8-azabicyclo[3.2.1]octan-3-one is sourced from PubChem (CID 126776530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).