About N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide
N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide (PubChem CID 126776789) has the molecular formula C8H9F2N3O
and a molecular weight of 201.18 g/mol. Its IUPAC name is N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide |
| PubChem CID | 126776789 |
| Molecular Formula | C8H9F2N3O |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC1CC(F)(F)C1)c1cn[nH]c1 |
| InChI | InChI=1S/C8H9F2N3O/c9-8(10)1-6(2-8)13-7(14)5-3-11-12-4-5/h3-4,6H,1-2H2,(H,11,12)(H,13,14) |
| InChIKey | DPZJTLDXWAOYMO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide?
The IUPAC name of N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide (CID 126776789) is N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide.
What is the SMILES notation for N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide?
The canonical SMILES for N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide is O=C(NC1CC(F)(F)C1)c1cn[nH]c1.
What is the InChIKey of N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide?
The InChIKey is DPZJTLDXWAOYMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2N3O/c9-8(10)1-6(2-8)13-7(14)5-3-11-12-4-5/h3-4,6H,1-2H2,(H,11,12)(H,13,14).
What are the key properties of N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide?
N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide has a molecular weight of 201.18 g/mol, XLogP of 0.94, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluorocyclobutyl)-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 126776789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).